Glucopiericidin B
It is produced by the strain of Streptomyces pactum S48727. Its antibacterial activity was stronger than Piericidin A1, and its inhibitory effect on antibody formation was also stronger than Piericidin A1.
Supplier | BOC Sciences |
---|---|
Product # | BBF-01264 |
Pricing | Inquire |
Cas | 108073-61-6 |
Molecular Weight | 577.71 |
Molecular Formula | C31H47NO6 |
Canonical SMILES | CC=C(C)C(C(C)C=C(C)C=CCC(=CCC1=C(C(=C(C(=N1)OC)OC)OC2C(C(C(C(O2)CO)O)O)O)C)C)O |