4-Aminophenyl b-D-thiogalactopyranoside
4-Aminophenyl b-D-thiogalactopyranoside is a remarkable chemical entity extensively utilized in the field of biomedical research. By functioning as an analog for the β-galactosidase enzyme, its paramount importance within a multitude of investigative pursuits becomes evident. To elucidate the intricacies of gene expression and protein-protein interactions, this compound serves as an indispensable resource. Its contributions extend to drug development, genetic engineering, and the elucidation of afflictions like lactose intolerance and select carcinoma manifestations.
| Supplier | BOC Sciences |
|---|---|
| Product # | 29558-05-2 |
| Pricing | Inquire |
| Cas | 29558-05-2 |
| Molecular Weight | 287.33 |
| Molecular Formula | C12H17NO5S |
| Canonical SMILES | C1=CC(=CC=C1N)SC2C(C(C(C(O2)CO)O)O)O |