MRT 10
MRT 10 is a smoothened (Smo) receptor antagonist (IC50 = 0.5 μM in HEK293 cells transiently expressing mouse Smo). It also inhibits bodipy-cyclopamine binding to the murine Smo receptor (IC50 = 0.5 μM) when expressed in HEK293 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 330829-30-6 |
| Pricing | Inquire |
| Cas | 330829-30-6 |
| Molecular Weight | 465.52 |
| Molecular Formula | C24H23N3O5S |
| Canonical SMILES | COC1=CC(=CC(=C1OC)OC)C(=O)NC(=S)NC2=CC=CC(=C2)NC(=O)C3=CC=CC=C3 |