4-Chloro-7-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine
4-Chloro-7-(3,5-di-O-benzoyl-2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine is a highly potent antiviral compound, finding extensive application within the biomedical sector for research of manifold viral infections. Displaying remarkable efficacy against a multitude of DNA and RNA viruses, this compound boasts of a distinctive molecular structure with the capacity to selectively target viral enzymes, thereby restraining their proliferation and thwarting viral dissemination.
| Supplier | BOC Sciences |
|---|---|
| Product # | 169516-55-6 |
| Pricing | Inquire |
| Cas | 169516-55-6 |
| Molecular Weight | 495.89 |
| Molecular Formula | C25H19ClFN3O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=CC4=C3N=CN=C4Cl)F)OC(=O)C5=CC=CC=C5 |