Chlorophyll a
Chlorophyll a is an important light-harvesting, green or blue color pigment present in the photosynthetic membranes of the chloroplasts in plant cells.
| Supplier | CD Formulation |
|---|---|
| Product # | PE-0217 |
| CAS # | 207-536-6 |
| Pricing | , Inquire for price |
| product1 | Pharmaceutical Excipients |
| Quality Level | 200.0 |
| Molecular Formula | C55H72MgN4O5 |
| Molecular Weight | 893.49 |
| Storage | -20°C |
| CAS Number | 479-61-8 |
| Category | Colorant Excipients |
| Appearance | Powder |
| MDL number | MFCD00079050 |
| NACRES | NA.47 |
| Purity | ≥85% (HPLC) |
| SMILES | CCc1c(C)c2cc3c(C=C)c(C)c4cc5nc([C@@H](CCC(=O)OC\C=C(/C)CCC[C@H](C)CCC[C@H](C)CCCC(C)C)[C@@H]5C)c6[C@@H](C(=O)OC)C(=O)c7c(C)c(cc1n2)n([Mg]n34)c67 |
| InChI | 1S/C55H73N4O5.Mg/c1-13-39-35(8)42-28-44-37(10)41(24-25-48(60)64-27-26-34(7)23-17-22-33(6)21-16-20-32(5)19-15-18-31(3)4)52(58-44)50-51(55(62)63-12)54(61)49-38(11)45(59-53(49)50)30-47-40(14-2)36(9)43(57-47)29-46(39)56-42;/h13,26,28-33,37,41,51H,1,14-25,27H2,2-12H3,(H-,56,57,58,59,61);/q-1;+2/p-1/b34-26+;/t32-,33-,37+,41+,51-;/m1./s1 |