Docetaxel EP Impurity D
Docetaxel EP Impurity D is an impurity of Docetaxel, which is a semisynthetic derivative of Paclitaxel used to treat a variety of cancers, including breast, head and neck, stomach, prostate, and non-small cell lung cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 162784-72-7 |
| Pricing | Inquire |
| Cas | 162784-72-7 |
| Molecular Weight | 805.86 |
| Molecular Formula | C43H51NO14 |
| Canonical SMILES | CC1=C2C(=O)C(=O)C3(C(CC4C(C3C(C(C2(C)C)(CC1OC(=O)C(C(C5=CC=CC=C5)NC(=O)OC(C)(C)C)O)O)OC(=O)C6=CC=CC=C6)(CO4)OC(=O)C)O)C |