Chloroorienticin D
Chloroorienticin D is produced by the strain of Amycolatopsis orientalis (Nocardia orientalis) PA-45052. Each component of Chloroorienticin had anti-Staphylococcus aureus and methicillin-resistant Staphylococcus aureus (MRSA) activity, and the activity was stronger than that of orientalis and vancomycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00313 |
| Pricing | Inquire |
| Cas | 118373-83-4 |
| Molecular Weight | 1606.46 |
| Molecular Formula | C74H90Cl2N10O26 |
| Canonical SMILES | CC1C(C(CC(O1)OC2C(C(C(OC2OC3=C4C=C5C=C3OC6=C(C=C(C=C6)C(C7C(=O)NC(C8=C(C(=CC(=C8)O)O)C9=C(C=CC(=C9)C(C(=O)N7)NC(=O)C5NC(=O)C(NC(=O)C(C(C1=CC(=C(O4)C=C1)Cl)O)NC(=O)C(CC(C)C)N(C)C)CC(=O)N)O)C(=O)O)OC1CC(C(C(O1)C)O)(C)N)Cl)CO)O)O)(C)N)O |