Phenylacetyl CoA
Phenylacetyl CoA is a derivative of Coenzyme A, which is utilized by the Bacillus Subtillis enzyme Sfp to transfer acyl phosphopantetheinyl moieties into the carrier protein substrate during the production of lipoheptapeptide antibiotic surfactin.
Supplier | BOC Sciences |
---|---|
Product # | 7532-39-0 |
Pricing | Inquire |
Cas | 7532-39-0 |
Molecular Weight | 885.67 |
Molecular Formula | C29H42N7O17P3S |
Canonical SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)C(C(=O)NCCC(=O)NCCSC(=O)CC4=CC=CC=C4)O |