Menoxymycin B
Menoxymycin B is an antibiotic produced by Str. sp. KB10. It has a cytotoxic effect. It inhibits KB and N18-RE-105 cells with IC50 of 0.22 μmol/L and 0.023 μmol/L. Dithiothreitol (DDT) can reduce A and B cytotoxicity effect.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01923 |
| Pricing | Inquire |
| Cas | 160523-76-2 |
| Molecular Weight | 489.51 |
| Molecular Formula | C25H31NO9 |
| Canonical SMILES | CC1C(C(CC(O1)C2=C(C3=C(C=C2)C(=O)C4=C(C3=O)C(OC(C4O)CC(=O)OC)C)O)N(C)C)O |