C18:1 LPA (ammonium salt)
Lysophosphatidic acid (LPA) belongs to a class of phospholipids that has a glycerol backbone attached by a phosphate group, an aliphatic chain and a hydroxyl group. It has a free hydroxyl and phosphate moiety. It is the major constituent of serum.
| Supplier | BOC Sciences |
|---|---|
| Product # | 799279-68-8 |
| Pricing | Inquire |
| Cas | 799279-68-8 |
| Molecular Weight | 439.57 |
| Molecular Formula | C21H46NO6P |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCCOCC(COP(=O)(O)O)[O-].[NH4+] |