5-Hydroxy-6-methoxy duloxetine sulfate sodium salt
5-Hydroxy-6-methoxy duloxetine sulfate sodium salt is a metabolite of Duloxetine, which is a serotonin-norepinephrine reuptake inhibitor used to treat major depressive disorder, generalized anxiety disorder, fibromyalgia, neuropathic pain and central sensitization.
| Supplier | BOC Sciences |
|---|---|
| Product # | 662149-10-2 |
| Pricing | Inquire |
| Cas | 662149-10-2 |
| Molecular Weight | 445.48 |
| Molecular Formula | C19H20NNaO6S2 |
| Canonical SMILES | CNCCC(C1=CC=CS1)OC2=CC=CC3=C2C=CC(=C3OS(=O)(=O)[O-])OC.[Na+] |