Lithocholic Acid 24-Ac-O-β-D-Glucuronide
Lithocholic Acid 24-Ac-O-β-D-Glucuronide is an impurity of Lithocholic acid, a cholic acid derivative as a TGR5 modulator. It is found in ox bile, human bile, rabbit bile, and in ox and pig gallstones.
| Supplier | BOC Sciences |
|---|---|
| Product # | 142780-61-8 |
| Pricing | Inquire |
| Cas | 142780-61-8 |
| Molecular Weight | 552.71 |
| Molecular Formula | C30H48O9 |
| Canonical SMILES | CC(CCC(=O)OC1C(C(C(C(O1)C(=O)O)O)O)O)C2CCC3C2(CCC4C3CCC5C4(CCC(C5)O)C)C |