5-Maleimidovalericacid-NHS
5-Maleimidovalericacid-NHS is a widely used bioconjugation reagent in the biomedical field, which can modify molecules such as proteins and peptides by establishing long-lasting amide bonds. This facilitates the creation of targeted medication management and diagnostic tools.
Supplier | BOC Sciences |
---|---|
Product # | BADC-00504 |
Pricing | Inquire |
Cas | 103750-03-4 |
Molecular Weight | 294.26 |
Molecular Formula | C13H14N2O6 |
Canonical SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCN2C(=O)C=CC2=O |