bis-ANS potassium salt
Bis-ANS is a fluorescent probe used for detection of protein conformation. Bis-ANS interacts with proteins through its hydrophobic phenyl and naphthyl rings. It has been used to detect Aβ fibre.
| Supplier | BOC Sciences |
|---|---|
| Product # | 65664-81-5 |
| Pricing | Inquire |
| Cas | 65664-81-5 |
| Molecular Weight | 672.9 |
| Molecular Formula | C32H22K2N2O6S2 |
| Canonical SMILES | C1=CC=C(C=C1)NC2=C3C(=C(C=C2)C4=C5C=CC=C(C5=C(C=C4)NC6=CC=CC=C6)S(=O)(=O)[O-])C=CC=C3S(=O)(=O)[O-].[K+].[K+] |