Vandetanib-[d4]
Vandetanib-[d4] is the labelled analogue of Vandetanib. Vandetanib is an antitumor drug used for the treatment of medullary thyroid cancer. Vandetanib effects through inhibiting vascular endothelial growth factor receptor-2 (VEGFR), epidermal growth factor receptor (EGFR) and the RET-tyrosine kinase activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012648 |
| Pricing | Inquire |
| Cas | 1215100-18-7 |
| Molecular Weight | 479.38 |
| Molecular Formula | C22H20D4BrFN4O2 |
| Canonical SMILES | CN1CCC(CC1)COC2=C(C=C3C(=C2)N=CN=C3NC4=C(C=C(C=C4)Br)F)OC |