2-Nitro-5-(2-propynyloxy)benzyl 4-cyano-4-(phenylcarbonothioylthio)pentanoate
RAFT agent for controlled radical polymerization; especially suited for the polymerization of methacrylate and methacrylamide monomers. Chain Transfer Agent (CTA) with alkyne functionality for ligation and a photo-sensitive moiety for controlled cleavage.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1318075-32-9 |
| Pricing | Inquire |
| Cas | 1318075-32-9 |
| Molecular Weight | 468.55 |
| Molecular Formula | C23H20N2O5S2 |
| Canonical SMILES | CC(CCC(=O)OCC1=C(C=CC(=C1)OCC#C)[N+](=O)[O-])(C#N)SC(=S)C2=CC=CC=C2 |