4-Methylumbelliferyl b-D-cellohexaoside
4-Methylumbelliferyl b-D-cellohexaoside is an exalted compound, used to study lysosomal storage disorders. Demonstrating its commendable prowess, it assumes the role of a judicious fluorogenic substrate, primed for enzymatic cleavage facilitated by the wondrous glucocerebrosidas.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84325-21-3 |
| Pricing | Inquire |
| Cas | 84325-21-3 |
| Molecular Weight | 1149.01 |
| Molecular Formula | C46H68O33 |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)CO)OC4C(C(C(C(O4)CO)OC5C(C(C(C(O5)CO)OC6C(C(C(C(O6)CO)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)O)O)O)O)O)O)O)O)O)O)O)O |