2-(4-formylbenzamido)ethyl nitrate
2-(4-formylbenzamido)ethyl nitrate is a multifaceted biomedical compound. This compound has shown remarkable ability to prevent the proliferation of specific malignant cells and has been widely recognized for its anti-tumor properties. In addition, its potent antibacterial efficacy against specific bacterial strains has attracted widespread scientific interest.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-00389 |
| Pricing | Inquire |
| Cas | 141534-26-1 |
| Molecular Weight | 238.19 |
| Molecular Formula | C10H10N2O5 |
| Canonical SMILES | C1=CC(=CC=C1C=O)C(=O)NCCO[N+](=O)[O-] |