SCH 221510
SCH 221510 is a potent and selective nociceptin opioid receptor (NOP) agonist (EC50 = 12, 693, 683 and 8071 nM, and Ki = 0.3, 65, 131 and 2854 nM at NOP, μ-, κ- and δ-opioid receptors, respectively). SCH 221510 exhibits anxiolytic-like activity at doses that have no effect on overt behaviors such as locomotion in vivo. SCH 221510 is used as the therapy of neuropathic and inflammatory pain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 322473-89-2 |
| Pricing | Inquire |
| Cas | 322473-89-2 |
| Molecular Weight | 397.55 |
| Molecular Formula | C28H31NO |
| Canonical SMILES | CC1=CC=CC=C1C(C2=CC=CC=C2C)N3C4CCC3CC(C4)(C5=CC=CC=C5)O |