8-(Di-tert-butylphosphinooxy)quinoline
8-(Di-tert-butylphosphinooxy)quinoline is a crucial compound used in the biomedical industry. It plays a significant role in treating various diseases like cancer by inhibiting specific enzymes or pathways. Through its unique chemical properties, it exhibits potent anti-tumor effects, aiding in the development of targeted therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1100332-44-2 |
| Pricing | Inquire |
| Cas | 1100332-44-2 |
| Molecular Weight | 289.35 |
| Molecular Formula | C17H24NOP |
| Canonical SMILES | CC(C)(C)P(C(C)(C)C)OC1=CC=CC2=C1N=CC=C2 |