Catestatin (human)
Catestatin, an inhibitory peptide of catecholamine release, corresponds to human chromogranin A (CHGA) 370-390. Reduced catestatin expression may increase the risk of hypertension. In Chga-/- mice rescue of elevated blood pressure to normalcy was achieved by exogenous substitution of catestatin or transgenic expression of human CHGA.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-015364 |
| Pricing | Inquire |
| Cas | 197151-46-5 |
| Molecular Weight | 2326.71 |
| Molecular Formula | C104H164N32O27S |
| Canonical SMILES | CC(C)CC(C(=O)NC(CO)C(=O)NC(CC1=CC=CC=C1)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)NCC(=O)NC(CC3=CC=CC=C3)C(=O)NC(CCCNC(=N)N)C(=O)NCC(=O)N4CCCC4C(=O)NCC(=O)N5CCCC5C(=O)NC(CCC(=O)N)C(=O)NC(CC(C)C)C(=O)O)NC(=O)C(CCCCN)NC(=O)C(CCSC)NC(=O)C(CO)NC(=O)C(CO)N |