7(18)-Dehydro Schisandrol A
7(18)-Dehydro Schisandrol A is an extremely natural compound sourced from Schisandra chinensis, demonstrating remarkable anti-inflammatory and antioxidant characteristics. Revered within the biomedical field, this product finds application in the research of diverse ailments like cancer, liver diseases and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 135095-47-5 |
| Pricing | Inquire |
| Cas | 135095-47-5 |
| Molecular Weight | 414.49 |
| Molecular Formula | C24H30O6 |
| Canonical SMILES | O(C1=CC2=C(C(OC)=C1OC)C3=C(OC)C(OC)=C(OC)C=C3CC(C(=C)C2)C)C |