Uridine 5'-Diphospho-α-D-glucose-[13C6] Diammonium Salt
Uridine 5'-Diphospho-α-D-glucose-[13C6] Diammonium Salt is a labelled derivative of phosphorylated uridine. It is used in nucleotide sugars metabolism as an activated form of glucose as a substrate for the enzyme glucosyltransferases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-013235 |
| Pricing | Inquire |
| Cas | 904293-00-1 |
| Molecular Weight | 606.32 |
| Molecular Formula | C9[13C]6H30N4O17P2 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OP(=O)(O)OC3C(C(C(C(O3)CO)O)O)O)O)O.N.N |