6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene
6-Bromo-2,3-dimethoxy-7-methyl-1-propylnaphthalene is an intermediate formed in the synthesis of 2,3-Dihydroxy-6-methyl-7-(phenylmethyl)-4-propyl-1-naphthalenecarboxylic Acid (D453265), which is used in the synthesis of novel lactate dehydrogenase A inhibitors. This compound is suitable for lactate dehydrogenase (LDH) related research.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB071953 |
| Pricing | Inquire |
| Cas | 213971-39-2 |
| Molecular Weight | 323.22 |
| Molecular Formula | C16H19BrO2 |
| Canonical SMILES | CCCC1=C2C=C(C(=CC2=CC(=C1OC)OC)Br)C |