2-[[4-[bis(2-hydroxyethyl)amino]phenyl]azo]-Benzoic acid
2-[[4-[bis(2-hydroxyethyl)amino]phenyl]azo]-Benzoic acid, a pharmaceutical compound utilized in the management of autoimmune conditions such as rheumatoid arthritis, operates as an anti-inflammatory agent through the suppression of specific enzymes implicated in the inflammatory cascade.
| Supplier | BOC Sciences |
|---|---|
| Product # | 6371-55-7 |
| Pricing | Inquire |
| Cas | 6371-55-7 |
| Molecular Weight | 329.35 |
| Molecular Formula | C17H19N3O4 |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)O)N=NC2=CC=C(C=C2)N(CCO)CCO |