N4-Benzoyl-2'-deoxy-2'-fluorocytidine
N4-Benzoyl-2'-deoxy-2'-fluorocytidine, an antiviral medication utilized in the treatment of HIV and HBV infections, is a potent inhibitor that thwarts transcription and reproduction of the virus. Due to its high selectivity for viral polymerases, it proficiently targets the afflicted cells, leaving intact ones unharmed. This nucleoside analogue reverse transcriptase blocking agent sustains its efficacy in neutralizing the viruses, shortly providing immense relief to the patients.
| Supplier | BOC Sciences |
|---|---|
| Product # | 146954-76-9 |
| Pricing | Inquire |
| Cas | 146954-76-9 |
| Molecular Weight | 349.31 |
| Molecular Formula | C16H16FN3O5 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)NC2=NC(=O)N(C=C2)C3C(C(C(O3)CO)O)F |