2-Amino-9-(2-O-methyl-β-D-ribofuranosyl)purine
2-Amino-9-(2-O-methyl-β-D-ribofuranosyl)purine is a renowned pharmaceutical compound, boasting its exceptional potency as an antiviral agent. With a distinctive focus on combating the likes of hepatitis C and diverse DNA viruses, this product manifests remarkable efficacy in hindering viral replication.
| Supplier | BOC Sciences |
|---|---|
| Product # | 274259-35-7 |
| Pricing | Inquire |
| Cas | 274259-35-7 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | COC1C(C(OC1N2C=NC3=CN=C(N=C32)N)CO)O |