4,5-Di-O-acetyl-2,6-anhydro-3-deoxy-D-erythro-hex-2-enononitrile
4,5-Di-O-acetyl-2,6-anhydro-3-deoxy-D-erythro-hex-2-enononitrile is a vital compound exhibiting potential in the development of drugs targeting various diseases. Through its chemical properties, it can specifically interact with certain receptors or enzymes aiding in the research of illnesses like cancer or inflammation. Its versatility and promising characteristics make it an interesting candidate for further research and drug discovery.
| Supplier | BOC Sciences |
|---|---|
| Product # | 120085-65-6 |
| Pricing | Inquire |
| Cas | 120085-65-6 |
| Molecular Weight | 225.20 |
| Molecular Formula | C10H11NO5 |
| Canonical SMILES | CC(=O)OC1COC(=CC1OC(=O)C)C#N |