(3b)-24-Bromo-3-[(tert-butyl)dimethylsilyloxy]-chol-5-ene
(3b)-24-Bromo-3-[(tert-butyl)dimethylsilyloxy]-chol-5-ene is a reactant used in the preparation of series of cholesterol side-chain analogs used in studies of the ω-regiospecificity of Mycobacterium tuberculosis cholesterol metabolizing cytochrome P 450 enzymes CYP124A1, CYP125A1 and CYP142A1.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB072288 |
| Pricing | Inquire |
| Cas | 1384736-07-5 |
| Molecular Weight | 537.73 |
| Molecular Formula | C30H53BrOSi |
| Canonical SMILES | CC(CCCBr)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)O[Si](C)(C)C(C)(C)C)C)C |