Blood Group B pentasaccharide
Blood Group B pentasaccharide, the carbohydrate molecule exhibiting promising anticoagulant properties for venous thromboembolism prevention, is a potent factor XIa inhibitor in the blood coagulation pathway. Its potential therapeutic implications extend to the treatment of and the development of novel agents for thrombotic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72468-43-0 |
| Pricing | Inquire |
| Cas | 72468-43-0 |
| Molecular Weight | 796.72 |
| Molecular Formula | C30H52O24 |
| Canonical SMILES | CC1C(C(C(C(O1)OC2C(C(OC(C2OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)O)O)OC5C(C(C(C(O5)C)O)O)O)CO)O)O)O)O)O |