4-Chloro-5-iodo-7-(2-deoxy-b-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine
4-Chloro-5-iodo-7-(2-deoxy-b-D-ribofuranosyl)-7H-pyrrolo[2,3-d]pyrimidine is an extraordinary and highly intricate pharmacological compound, demonstrating its profound efficacy in research of an array of malignant neoplasms. Renowned for its ability to suppress oncogenesis through the impeding of cancer cell proliferation and interruption of DNA duplication, this compound manifests promising outcomes in the research of leukemia, solid tumors is and other diversified malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-075849 |
| Pricing | Inquire |
| Cas | 178995-71-6 |
| Molecular Weight | 395.58 |
| Molecular Formula | C11H11ClIN3O3 |
| Canonical SMILES | C1C(C(OC1N2C=C(C3=C2N=CN=C3Cl)I)CO)O |