2'-O-ribosyladenosine (phosphate)
2'-O-ribosyladenosine (phosphate), a significant enzyme in RNA production, modifies nucleotides in RNA formation for mRNA molecule production used in protein synthesis. In addition, the product is crucial for biosynthesis of purine, a crucial molecular base in DNA and RNA. With targeted inhibition of certain cancer cells, this potent tool finds wide application in cancer treatment research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 28050-13-7 |
| Pricing | Inquire |
| Cas | 28050-13-7 |
| Molecular Weight | 479.34 |
| Molecular Formula | C15H22N5O11P |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)CO)O)OC4C(C(C(O4)COP(=O)(O)O)O)O)N |