2-Amino-6-methylthio-9-(2'-deoxy-2'-fluoro-beta-D-arabinofuranosyl)-9H-purine
2-Amino-6-methylthio-9-(2'-deoxy-2'-fluoro-beta-D-arabinofuranosyl)-9H-purine is an exceptionally influential antiviral compound extensively employed for research of viral infections, specifically those emanating from the herpes virus. By means of retarding the synthesis of viral DNA, this compound effectively obstructs viral replication and disseminated infection throughout the organism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109304-11-2 |
| Pricing | Inquire |
| Cas | 109304-11-2 |
| Molecular Weight | 315.32 |
| Molecular Formula | C11H14FN5O3S |
| Canonical SMILES | CSC1=NC(=NC2=C1N=CN2C3C(C(C(O3)CO)O)F)N |