Lacto-N-fucopentaose V
Lacto-N-fucopentaose V, a groundbreaking biomedicine product, emerges as a pivotal therapeutic entity in the daunting battle against several diseases. Extensive scientific investigations have unraveled its potential prowess in cancer therapy by augmenting immune responses to combat malignant neoplasms. Moreover, its remarkable attributes offer hope in alleviating inflammatory bowel disease through the regulation of gut-associated inflammatory reactions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 60254-64-0 |
| Pricing | Inquire |
| Cas | 60254-64-0 |
| Molecular Weight | 853.77 |
| Molecular Formula | C32H55NO25 |
| Canonical SMILES | CC1C(C(C(C(O1)OC(C(C=O)O)C(C(CO)O)OC2C(C(C(C(O2)CO)O)OC3C(C(C(C(O3)CO)O)OC4C(C(C(C(O4)CO)O)O)O)NC(=O)C)O)O)O)O |