5-Bromo-2',3'-dideoxyuridine
5-Bromo-2',3'-dideoxyuridine stands as an exemplary nucleoside analog, exhibiting remarkable antiviral prowess. Revered for its potential in combating viral infections instigated by herpesviruses, most notably herpes simplex and varicella-zoster viruses, this therapeutic agent actively hampers viral DNA polymerase, safeguarding against replication and dispersal. This distinctive mode of operation positions it as a formidable contender within the realm of antiviral therapy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 28616-93-5 |
| Pricing | Inquire |
| Cas | 28616-93-5 |
| Molecular Weight | 291.1 |
| Molecular Formula | C9H11BrN2O4 |
| Canonical SMILES | C1CC(OC1CO)N2C=C(C(=O)NC2=O)Br |