Griseolic acid C
It is produced by the strain of Streptomyces griseoaurantiacus SANK43894. It has the activity of inhibiting cyclic adenosine monophosphate (cAMP) phosphodiesterase [EC 3.1.4.17] with IC50 0.12 X 10-6 mol/L (Extracted from rat brain).
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01287 |
| Pricing | Inquire |
| Cas | 100242-49-7 |
| Molecular Weight | 365.30 |
| Molecular Formula | C14H15N5O7 |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C(N=CN=C43)N)O)OC1(CC(=O)O)C(=O)O |