Methyltetrazine-PEG8-amine HCl salt
Methyltetrazine-PEG8-amine is an aqueous soluble amine-containing click chemistry crosslinker. Methyl group improves the stability and hydrophilic PEG spacer increases water-solubility. The amine (NH2) group is reactive with carboxylic acid containing molecule in the presence of reagnet such as EDC or HATU. Methyltetrazine enable fast click reaction with TCO (trans-cycloctene)
| Supplier | BOC Sciences |
|---|---|
| Product # | R08-0041 |
| Pricing | Inquire |
| Molecular Weight | 576.1 |
| Molecular Formula | C25H42ClN5O8 |
| Canonical SMILES | CC1=NN=C(N=N1)C2=CC=C(C=C2)OCCOCCOCCOCCOCCOCCOCCOCCN.Cl |