b-D-Maltose octaacetate
b-D-Maltose octaacetate is a chemical compound widely used in the compound industry. It is primarily utilized as a precursor for various pharmaceutical drugs, particularly in the research of diabetes and cardiovascular diseases. This compound plays a crucial role in the research and development of therapeutic agents aimed at controlling blood sugar levels and improving heart health.
| Supplier | BOC Sciences |
|---|---|
| Product # | 22352-19-8 |
| Pricing | Inquire |
| Cas | 22352-19-8 |
| Molecular Weight | 678.59 |
| Molecular Formula | C28H38O19 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |