2,4-Dichlorophenoxyacetic acid sodium salt
2,4-D sodium salt is a selective systemic herbicide, which can be used for broad-leaved weeds control. It acts as a plant hormone, causing uncontrolled growth of meristematic tissues. It inhibits the synthesis of DNA and protein, thus hindering the normal growth and development of plants.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2702-72-9 |
| Pricing | Inquire |
| Cas | 2702-72-9 |
| Molecular Weight | 243.02 |
| Molecular Formula | C8H5Cl2NaO3 |
| Canonical SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)[O-].[Na+] |