4-FLUORO-2-PROPOXYPHENYLBORONIC ACID
4-FLUORO-2-PROPOXYPHENYLBORONIC ACID is a paramount biomedical compound that renowned for its prowess in combating cancer and inflammatory afflictions. This extraordinary compound is a derivative of boronic acid and exhibits remarkable specificity towards disease-associated proteins, culminating in impeded disease progression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 480438-60-6 |
| Pricing | Inquire |
| Cas | 480438-60-6 |
| Molecular Weight | 198 |
| Molecular Formula | C9H12BFO3 |
| Canonical SMILES | B(C1=C(C=C(C=C1)F)OCCC)(O)O |