2',3'-Dideoxy-5-fluorouridine
2',3'-Dideoxy-5-fluorouridine, a potent antiviral drug, is efficaciously employed for treating viral infections such as HIV and hepatitis B. This drug foils virus replication and curbs further transmission to healthy cells with unprecedented precision and accuracy. Furthermore, its immense potential to treat cancer is being exhaustively studied, warranting its indispensability in the medical fraternity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 15379-30-3 |
| Pricing | Inquire |
| Cas | 15379-30-3 |
| Molecular Weight | 230.19 |
| Molecular Formula | C9H11FN2O4 |
| Canonical SMILES | C1CC(OC1CO)N2C=C(C(=O)NC2=O)F |