1,2-Diamino-4,5-dimethoxybenzene Hydrochloride
1,2-Diamino-4,5-dimethoxybenzene Hydrochloride is the salt form of 1,2-Diamino-4,5-dimethoxybenzene (D416425), which reacts with aldehydes to produce highly fluorescent benzimidazole derivatives. It can be used for the detection of aldehydes as well as DTAN.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068237 |
| Pricing | Inquire |
| Cas | 225645-97-6 |
| Molecular Weight | 168.19 + x(36.46) |
| Molecular Formula | C8H12N2O2·x(HCl) |
| Canonical SMILES | COC1=C(C=C(C(=C1)N)N)OC.Cl |