6-Benzylamino-9-(b-D-arabinofuranosyl)purine
6-Benzylamino-9-(b-D-arabinofuranosyl)purine, a synthetic nucleoside analog, showcases potent antiviral and anti-tumor activity. It serves as a key agent in the treatment of several malignancies, especially leukemia and lymphoma. Additionally, it offers remedy to viral infections such as hepatitis B and C by curbing viral DNA and RNA development, effectively forestalling their propagation and dissemination.
| Supplier | BOC Sciences |
|---|---|
| Product # | 42519-51-7 |
| Pricing | Inquire |
| Cas | 42519-51-7 |
| Molecular Weight | 357.37 |
| Molecular Formula | C17H19N5O4 |
| Canonical SMILES | C1=CC=C(C=C1)CNC2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)O)O |