SCH 23390 hydrochloride
SCH 23390 hydrochloride is the hydrochloride salt of SCH 23390 which is a dopamine receptor antagonist. SCH 23390, a halobenzazepine, is a selective antagonist of the dopamine D1-like receptor subtypes D1 (Kis = 0.2 nM) and D5 (Kis = 0.3 nM).
| Supplier | BOC Sciences |
|---|---|
| Product # | 125941-87-9 |
| Pricing | Inquire |
| Cas | 125941-87-9 |
| Molecular Weight | 324.24 |
| Molecular Formula | C17H19Cl2NO |
| Canonical SMILES | CN1CCC2=CC(=C(C=C2C(C1)C3=CC=CC=C3)O)Cl.Cl |