b-D-Xylopyranosyl nitromethane
b-D-Xylopyranosyl nitromethane, a biomedical product, finds wide application in the therapeutic management of diverse disorders. Exhibiting potential as a drug, it effectively combats microbial infections, cancer, and parasitic diseases. The distinctive chemical characteristics of b-D-Xylopyranosyl nitromethane demonstrate promising outcomes towards inhibiting tumor progression and curtailing pathogen proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20204-84-6 |
| Pricing | Inquire |
| Cas | 20204-84-6 |
| Molecular Weight | 193.15 |
| Molecular Formula | C6H11NO6 |
| Canonical SMILES | C1C(C(C(C(O1)C[N+](=O)[O-])O)O)O |