9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-phenylpurine
9-(3-Deoxy-3-fluoro-β-D-ribofuranosyl)-6-phenylpurine, known for its potent antiviral properties, showcases remarkable efficacy in combating selected viral infections. By selectively inhibiting key enzymes crucial for viral RNA synthesis, this therapeutic agent effectively hampers viral replication. Groundbreaking results have been observed in the management of RNA virus-induced ailments like hepatitis C and influenza.
Supplier | BOC Sciences |
---|---|
Product # | 1612191-91-9 |
Pricing | Inquire |
Cas | 1612191-91-9 |
Molecular Weight | 330.31 |
Molecular Formula | C16H15FN4O3 |
Canonical SMILES | C1=CC=C(C=C1)C2=C3C(=NC=N2)N(C=N3)C4C(C(C(O4)CO)F)O |