Caspase-2 Inhibitor Z-VDVAD-FMK
| Supplier | Creative Peptides |
|---|---|
| Product # | R1111 |
| CAS # | 210344-95-9 |
| Pricing | Inquire |
| LabelingTarget | Caspase-2 |
| Synonyms | Benzyloxycarbonyl-Val-Asp(OMe)-Val-Ala-Asp(OMe)-fluoromethylketone |
| MolecularFormula | C32H46FN5O11 |
| MolecularWeight | 695.7 |
| Sequence | VDVAD (Modifications: N-terminal benzyloxycarbonyl; C-terminal FMK; Asp-2 = Asp(OMe); Asp-5 = Asp(OMe)) |
| Storage | -20°C |
| Explanation | Z-VDVAD-FMK is a synthetic peptide that irreversibly inhibits the activity of caspase-2. It attenuates oxyhemoglobin-induced cleavage of PARP and apoptosis in endothelial cells. Z-VDVAD-FMK can be used for both in vitro and in vivo studies. |
| Application | Z-VDVAD-FMK (Caspase-2 inhibitor) is a cell-permeable, irreversible inhibitor of caspase-2. Caspase inhibitors play an important role in investigating biological processes. The caspase family of proteins function as key components of the apoptotic machinery and act to destroy specific target proteins which are critical to cellular longevity. |
| Activity | Inhibitor |
| InChI | InChI=1S/C30H41FN4O12/c1-17(2)26(29(42)33-20(22(36)15-31)13-24(38)45-4)35-27(40)19(11-12-23(37)44-3)32-28(41)21(14-25(39)46-5)34-30(43)47-16-18-9-7-6-8-10-18/h6-10,17,19-21,26H,11-16H2,1-5H3,(H,32,41)(H,33,42)(H,34,43)(H,35,40)/t19-,20-,21-,26-/m0/s1 |
| InChIKey | GBJVAVGBSGRRKN-JYEBCORGSA-N |
| Solubility | Soluble in DMSO |
| IsomericSMILES | CC(C)[C@@H](C(=O)N[C@@H](CC(=O)OC)C(=O)CF)NC(=O)[C@H](CCC(=O)OC)NC(=O)[C@H](CC(=O)OC)NC(=O)OCC1=CC=CC=C1 |
| Appearance | White lyophilised solid |
| Purity | >98% |
| AreasOfInterest |
|
| LongTermStorageConditions | -20 °C |