2'-Deoxy-3'-O-methylguanosine
2'-Deoxy-3'-O-methylguanosine is a compound widely utilized in the field of biomedicine, exhibiting immense potential for various pharmaceutical applications. Renowned for its remarkable chemical properties, this product assuming a pivotal role in drug research, specifically targeting afflictions encompassing cancer, viral infections, and immune disorders. An invaluable asset in the realm of scientific investigation, its utility extends to the exploration of DNA methylation and RNA modifications, enabling profound insights into the intricacies of disease mechanisms and the formulation of precise therapeutic interventions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76551-22-9 |
| Pricing | Inquire |
| Cas | 76551-22-9 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | COC1CC(OC1CO)N2C=NC3=C2N=C(NC3=O)N |