8-Formyl ophiopogonanone B
8-Formyl ophiopogonanone B, known for its impressive therapeutic potential in the biomedical sphere in studying a plethora of diseases, is an incredibly robust natural compound. Its capacity to selectively engage and modulate tumor progression-associated molecular routes has positioned it as a striking contender in the developmentof anticancer agents.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1316224-76-6 |
| Pricing | Inquire |
| Cas | 1316224-76-6 |
| Molecular Weight | 342.34 |
| Molecular Formula | C19H18O6 |
| Canonical SMILES | CC1=C(C(=C2C(=C1O)C(=O)C(CO2)CC3=CC=C(C=C3)OC)C=O)O |