Dimepranol Related Compound (N,N-Dimethylamino-2-propanol p-Acetamido benzoic acid)
N,N-Dimethylamino-2-propanol isa component of some pharmaceutical preparations including inosine pranobex.. Inosine pranobex has no effect on viral particles itself. It acts as a immunostimulant, an analog of thymus hormones.
| Supplier | BOC Sciences |
|---|---|
| Product # | 61990-51-0 |
| Pricing | Inquire |
| Cas | 61990-51-0 |
| Molecular Weight | 282.34 |
| Molecular Formula | C14H22N2O4 |
| Canonical SMILES | CC(CN(C)C)O.CC(=O)NC1=CC=C(C=C1)C(=O)O |